| Identification | |
| Name: | 9-Hydroxy-9-fluorenecarboxylic acid |
| Synonyms: | 9-Hydroxyfluorene-9-carboxylic acid; Flurenol Pestanal; 9-Hydroxy-9-Fluororenecarboxylic Acid; Flurenol; 9-Hydroxy-9-fluorene carboxylic acid |
| CAS: | 467-69-6 |
| EINECS: | 207-397-1 |
| Molecular Formula: | C14H10O3 |
| Molecular Weight: | 226.2274 |
| InChI: | InChI=1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 1.45 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | off-white crystalline powder |
| Specification: |
Flurecol , its CAS NO. is 467-69-6, the synonyms are 3-10-00-01251 (Beilstein Handbook Reference) ; 9-Hydooxyfluorene-9-carboxylic acid ; BRN 1314711 ; EINECS 207-397-1 ; Glycolic acid, diphenylene- ; NSC 97576 . |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Plant growth regulator. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
