| Identification | |
| Name: | 2H-3,1-Benzoxazine-2,4(1H)-dione,6-methyl- |
| Synonyms: | 5-Methylisatoicanhydride; 6-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione;6-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione; NSC 163034 |
| CAS: | 4692-99-3 |
| Molecular Formula: | C9H7 N O3 |
| Molecular Weight: | 177.1568 |
| InChI: | InChI=1/C9H7NO3/c1-5-2-3-7-6(4-5)8(11)13-9(12)10-7/h2-4H,1H3,(H,10,12) |
| Molecular Structure: | ![(C9H7NO3) 5-Methylisatoicanhydride; 6-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione;6-Methyl-2H-3,1-benzoxazine-2,4...](https://img1.guidechem.com/chem/e/dict/37/4692-99-3.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.335 g/cm3 |
| Refractive index: | 1.575 |
| Specification: |
2H-3,1-Benzoxazine-2,4(1H)-dione,6-methyl- , with CAS number of 4692-99-3, can be called 6-methyl-1H-benzo[d][1,3]oxazine-2,4-dione ; 6-Methyl isatinic anhydride ; 5-Methylisatoic anhydride ; 6-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione ; 2H-3,1-benzoxazine-2,4(1H)-dione, 6-methyl- . |
| Flash Point: | °C |
| Safety Data | |
 |
|
