| Identification | |
| Name: | 2H-3,1-Benzoxazine-2,4(1H)-dione,6-nitro- |
| Synonyms: | 5-Nitroisatoicanhydride; 6-Nitro-1H-benzo[d][1,3]oxazine-2,4-dione; NSC 73615 |
| CAS: | 4693-02-1 |
| EINECS: | 225-151-1 |
| Molecular Formula: | C8H4 N2 O5 |
| Molecular Weight: | 208.14 |
| InChI: | InChI=1/C8H4N2O5/c11-7-5-3-4(10(13)14)1-2-6(5)9-8(12)15-7/h1-3H,(H,9,12) |
| Molecular Structure: | ![(C8H4N2O5) 5-Nitroisatoicanhydride; 6-Nitro-1H-benzo[d][1,3]oxazine-2,4-dione; NSC 73615](https://img1.guidechem.com/chem/e/dict/28/4693-02-1.jpg) |
| Properties | |
| Melting Point: | 259 °C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.623g/cm3 |
| Refractive index: | 1.629 |
| Specification: |
6-Nitroisatoic anhydride ,its cas register number is 4693-02-1. It also can be called 6-Nitro-2H-3,1-benzoxazine-2,4(1H)-dione ; 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-nitro- and 5-Nitroisatoic anhydride . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | °C |
| Safety Data | |
 |
|
