| Identification | |
| Name: | Tetramethyldiarsine |
| Synonyms: | cacodyl;tetramethyldiarsane |
| CAS: | 471-35-2 |
| EINECS: | 207-440-4 |
| Molecular Formula: | C4H12As2 |
| Molecular Weight: | 209.9813 |
| InChI: | InChI=1/C4H12As2/c1-5(2)6(3)4/h1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 17.5°C |
| Boiling Point: | 165°C at 760 mmHg |
| Specification: |
Tetramethyldiarsine , its cas register number is 471-35-2. It also can be called Tetramethyldiarsenic ; and Diarsine, tetramethyl- . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 17.5°C |
| Safety Data | |
 |
|
