| Identification | |
| Name: | Ethane,1,1-dichloro-2,2-difluoro- |
| Synonyms: | 1,1-Dichloro-2,2-difluoroethane;1,1-Difluoro-2,2-dichloroethane; F 132a; HCFC 132a; R 132a |
| CAS: | 471-43-2 |
| Molecular Formula: | C2H2 Cl2 F2 |
| Molecular Weight: | 134.94 |
| InChI: | InChI=1/C2H2Cl2F2/c3-1(4)2(5)6/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Flash Point: | °C |
| Boiling Point: | 60.9°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Refractive index: | 1.361 |
| Specification: | Safety Statements:23-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
Xi: Irritant
|
 |
|
