Identification |
Name: | Acetic acid,2-chloro-2-fluoro- |
Synonyms: | Aceticacid, chlorofluoro- (6CI,7CI,8CI,9CI); Chlorofluoroacetic acid; NSC 95117 |
CAS: | 471-44-3 |
Molecular Formula: | C2H2 Cl F O2 |
Molecular Weight: | 112.49 |
InChI: | InChI=1/C2H2ClFO2/c3-1(4)2(5)6/h1H,(H,5,6) |
Molecular Structure: |
 |
Properties |
Transport: | 3265 |
Flash Point: | 58.6°C |
Boiling Point: | 162°Cat760mmHg |
Density: | 1.532g/cm3 |
Refractive index: | 1.4085 |
Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 58.6°C |
Safety Data |
Hazard Symbols |
C: Corrosive
Xi: Irritant
|
|
 |