| Identification | |
| Name: | Acetic acid,2-chloro-2-fluoro- |
| Synonyms: | Aceticacid, chlorofluoro- (6CI,7CI,8CI,9CI); Chlorofluoroacetic acid; NSC 95117 |
| CAS: | 471-44-3 |
| Molecular Formula: | C2H2 Cl F O2 |
| Molecular Weight: | 112.49 |
| InChI: | InChI=1/C2H2ClFO2/c3-1(4)2(5)6/h1H,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 58.6°C |
| Boiling Point: | 162°Cat760mmHg |
| Density: | 1.532g/cm3 |
| Refractive index: | 1.4085 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 58.6°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xi: Irritant
|
 |
|
