| Identification | |
| Name: | 2-Naphthalenecarboxamide,N-(2-ethoxyphenyl)- |
| Synonyms: | 2-Naphthalenecarboxamide, N-(2-ethoxyphenyl)-;N-(2-Ethoxyphenyl)-2-naphthalenecarboxamide;Einecs 225-199-3;N-(2-ethoxyphenyl)naphthalene-2-carboxamide;2-HYDROXY-3-NAPHTHOYL-P-AMINOACETO-ANILINE; |
| CAS: | 4711-67-5 |
| EINECS: | 225-199-3 |
| Molecular Formula: | C19H17 N O2 |
| Molecular Weight: | 291.34 |
| InChI: | InChI=1/C19H17NO2/c1-2-22-18-10-6-5-9-17(18)20-19(21)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,2H2,1H3,(H,20,21) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.199 g/cm3 |
| Refractive index: | 1.662 |
| Specification: |
The N-(2-Ethoxyphenyl)naphthalene-2-carboxamide with cas registry number of 4711-67-5, is also named N-(2-Ethoxyphenyl)-2-naphthalenecarboxamide ; Einecs 225-199-3 . Physical properties of N-(2-Ethoxyphenyl)naphthalene-2-carboxamide :(1)ACD/LogP: 4.28; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.28; (4)ACD/LogD (pH 7.4): 4.28; (5)ACD/BCF (pH 5.5): 1052.67; (6)ACD/BCF (pH 7.4): 1052.82; (7)ACD/KOC (pH 5.5): 5069.19; (8)ACD/KOC (pH 7.4): 5069.9; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 29.54 Å2; (13)Index of Refraction: 1.662; (14)Molar Refractivity: 89.98 cm3; (15)Molar Volume: 242.9 cm3; (16)Polarizability: 35.67×10-24cm3; (17)Surface Tension: 50.3 dyne/cm; (18)Enthalpy of Vaporization: 64.59 kJ/mol; (19)Vapour Pressure: 1.8E-06 mmHg at 25°C. The N-(2-Ethoxyphenyl)naphthalene-2-carboxamide is mainly used in making organic pigment. You can still convert the following datas into molecular structure: (1)SMILES:O=C(c2cc1ccccc1cc2)Nc3ccccc3OCC; (2)InChI:InChI=1/C19H17NO2/c1-2-22-18-10-6-5-9-17(18)20-19(21)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,2H2,1H3,(H,20,21); (3)InChIKey:NYJJPJOPGCYXIF-UHFFFAOYAD; (4)Std. InChI:InChI=1S/C19H17NO2/c1-2-22-18-10-6-5-9-17(18)20-19(21)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,2H2,1H3,(H,20,21); (5)Std. InChIKey:NYJJPJOPGCYXIF-UHFFFAOYSA-N. |
| Safety Data | |
 |
|
