| Identification |
| Name: | Phosphonic acid,diphenyl ester |
| Synonyms: | Phenylphosphonate ((PhO)2HPO) (6CI,7CI);Diphenoxyphosphine oxide;Diphenyl hydrogenphosphite;Diphenyl phosphonate;Doverphos 213;JP 260;NSC43786;Weston DPP; |
| CAS: | 4712-55-4 |
| EINECS: | 225-202-8 |
| Molecular Formula: | C12H11O3P |
| Molecular Weight: | 234.19 |
| InChI: | InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1760 |
| Melting Point: | 12 oC |
| Flash Point: | 350 oF |
| Boiling Point: | 218-219 oC26 mm Hg(lit.) |
| Refractive index: | n20/D 1.558(lit.) |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Flash Point: | 350 oF |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
