| Identification |
| Name: | 2-Propenamide,3-(4-chlorophenyl)-N-(3-methoxyphenyl)- |
| Synonyms: | SB 366791 |
| CAS: | 472981-92-3 |
| Molecular Formula: | C16H14 Cl N O2 |
| Molecular Weight: | 287.74 |
| InChI: | InChI=1/C16H14ClNO2/c1-20-15-4-2-3-14(11-15)18-16(19)10-7-12-5-8-13(17)9-6-12/h2-11H,1H3,(H,18,19)/b10-7+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 252.7°C |
| Boiling Point: | 494.2°Cat760mmHg |
| Density: | 1.265g/cm3 |
| Refractive index: | 1.65 |
| Biological Activity: | Potent, selective and competitive vanilloid TRPV1 (VR1) receptor antagonist (pA 2 = 7.71 at hVR1); antagonizes hTRPV1 receptors activated by agonists, noxious heat, but not protons. Displays selectivity over a wide range of receptors and systems including CB 1 and CB 2 receptors, voltage-gated Ca 2+ channels and the hyperpolarization-activated current (I h ). Also available as part of the Vanilloid TRPV1 Receptor Tocriset™ . |
| Flash Point: | 252.7°C |
| Color: | off-white |
| Safety Data |
| |
 |
