| Identification | |
| Name: | 2-Pyridinecarboxylicacid, 3-(aminocarbonyl)- |
| Synonyms: | Picolinicacid, 3-carbamoyl- (8CI); Picolinic acid, 3-carbamyl- (4CI);3-Amidopyridine-2-carboxylic acid; 3-Carbamoyl-a-picolinic acid; 3-Carbamoylpicolinic acid;Quinolin-3-amic acid |
| CAS: | 4733-65-7 |
| Molecular Formula: | C7H6 N2 O3 |
| Molecular Weight: | 166.13 |
| InChI: | InChI=1/C7H6N2O3/c8-6(10)4-2-1-3-9-5(4)7(11)12/h1-3H,(H2,8,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.3°C |
| Boiling Point: | 440.6°Cat760mmHg |
| Density: | 1.458g/cm3 |
| Refractive index: | 1.623 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 220.3°C |
| Safety Data | |
 |
|
