| Identification | |
| Name: | Estra-1,3,5(10),7-tetraen-17-one,3-hydroxy- |
| Synonyms: | Equilin(6CI,7CI); 1,3,5,7-Estratetraen-3-ol-17-one;3-Hydroxyestra-1,3,5(10),7-tetraen-17-one; 7-Dehydroestrone; NSC 10971 |
| CAS: | 474-86-2 |
| EINECS: | 207-488-6 |
| Molecular Formula: | C18H20 O2 |
| Molecular Weight: | 268.38 |
| InChI: | InChI=1/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16,19H,2,6-9H2,1H3/t14?,16?,18-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.22 g/cm3 |
| Refractive index: | 1.626 |
| Appearance: | plate powder, soluble in alcohol, acetone, sparingly soluble in water. |
| Specification: | Off-White Solid usageEng:An estrogen found in Premarin, which is a mixture of conjugated estrogens widely used in hormone replacement therapy. Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| Storage Temperature: | Refrigerator |
| Usage: | An estrogen found in Premarin, which is a mixture of conjugated estrogens widely used in hormone replacement therapy. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
