Identification |
Name: | 1(3H)-Isobenzofuranone,6-methoxy- |
Synonyms: | Phthalide,6-methoxy- (6CI,8CI); 6-Methoxyisobenzofuran-1(3H)-one; 6-Methoxyphthalide; NSC319476 |
CAS: | 4741-63-3 |
Molecular Formula: | C9H8 O3 |
Molecular Weight: | 164.158 |
InChI: | InChI=1/C9H8O3/c1-11-7-3-2-6-5-12-9(10)8(6)4-7/h2-4H,5H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 150.4°C |
Boiling Point: | 360.4°Cat760mmHg |
Density: | 1.262g/cm3 |
Refractive index: | 1.562 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 150.4°C |
Safety Data |
|
 |