| Identification | |
| Name: | N-isopropylmethylamine |
| Synonyms: | N-methylisopropylamine |
| CAS: | 4747-21-1 |
| EINECS: | 225-266-7 |
| Molecular Formula: | C4H11N |
| Molecular Weight: | 73.14 |
| InChI: | InChI=1/C4H11N/c1-4(2)5-3/h4-5H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Melting Point: | -101 |
| Flash Point: | -25? |
| Density: | 0.702 |
| Stability: | No data. |
| Refractive index: | 1.384 |
| Solubility: | Very soluble |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | II |
| Flash Point: | -25? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
