Identification |
Name: | 1(2H)-Phthalazinone,4-[(4-chlorophenyl)methyl]-2-(hexahydro-1H-azepin-4-yl)- |
Synonyms: | Demethylazelastine;Desmethylazelastine |
CAS: | 47491-38-3 |
Molecular Formula: | C21H22 Cl N3 O |
Molecular Weight: | 0 |
InChI: | InChI=1/C21H22ClN3O/c22-16-9-7-15(8-10-16)14-20-18-5-1-2-6-19(18)21(26)25(24-20)17-4-3-12-23-13-11-17/h1-2,5-10,17,23H,3-4,11-14H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 282.8°C |
Boiling Point: | 544.1°Cat760mmHg |
Density: | 1.29g/cm3 |
Refractive index: | 1.66 |
Specification: | Pale Yellow Solid usageEng:The main phase I metabolites of Azelastine |
Flash Point: | 282.8°C |
Storage Temperature: | Refrigerator |
Usage: | The main phase I metabolites of Azelastine |
Safety Data |
|
|