Identification |
Name: | Phenanthro[3,4-d]-1,3-dioxole-5-carboxylicacid, 6-nitro- |
Synonyms: | Aristolochic acidII (6CI); 3,4-(Methylenedioxy)-10-nitrophenanthrene-1-carboxylic acid;Aristolochic acid B |
CAS: | 475-80-9 |
EINECS: | 207-499-6 |
Molecular Formula: | C16H9 N O6 |
Molecular Weight: | 311.26 |
InChI: | InChI=1/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19) |
Molecular Structure: |
|
Properties |
Transport: | 2811 |
Density: | 1.61 g/cm3 |
Refractive index: | 1.786 |
Packinggroup: | III |
Usage: | Aristolochic acids occur in Aristolochiaceae and in butterflies feeding on these plants. One of a group of fourteen known, substituted 1-phenanthrenecarboxylic acids |
Safety Data |
|
|