| Identification | |
| Name: | Ellagic acid |
| Synonyms: | Alizarinyellow;Alizarine Yellow;Benzoaric acid;C.I. 55005;C.I. 75270;Elagostasine; |
| CAS: | 476-66-4 |
| EINECS: | 207-508-3 |
| Molecular Formula: | C14H6O8 |
| Molecular Weight: | 302.19264 |
| InChI: | InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.667 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.894 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | gray to slightly beige crystalline powder |
| Specification: | cream to light yellow crystalline solid Safety Statements:26-36-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37:Wear suitable protective clothing and gloves |
| Biological Activity: | Selective, ATP-competitive inhibitor of casein kinase 2 (CK2) (IC 50 values are 40, 2900, 3500, 4300 and 9400 nM for CK2, Lyn, PKA, Syk? and FGR respectively). Exhibits antioxidant, antitumor and anticarcinogenic activity and also inhibits glutathione S-transferase. |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air & Light Sensitive |
| Color: | tan to gray |
| Usage: | Astringent. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
