Identification |
Name: | 4H-Dibenzo[de,g]quinoline-2,9-diol,5,6,6a,7-tetrahydro-1,10-dimethoxy-6-methyl-, (6aS)- |
Synonyms: | 4H-Dibenzo[de,g]quinoline-2,9-diol,5,6,6a,7-tetrahydro-1,10-dimethoxy-6-methyl-, (S)-;6aa-Aporphine-2,9-diol,1,10-dimethoxy- (8CI);Boldine (6CI,7CI);(+)-(S)-Boldine;(+)-2,9-Dihydroxy-1,10-dimethoxyaporphine;(+)-Boldine;(S)-(+)-Boldine;(S)-Boldine;1,10-Dimethoxy-6aa-aporphine-2,9-diol; |
CAS: | 476-70-0 |
EINECS: | 207-509-9 |
Molecular Formula: | C19H21NO4 |
Molecular Weight: | 327.37 |
InChI: | InChI=1/C19H21NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | 1544 |
Density: | 1.29 g/cm3 |
Refractive index: | 1.638 |
Specification: |
It exists in leaves of the Peumus boldus and Molina,Litsea glutinosa CB Rob. .We can get it from the racemic in chemical synthesis.
|
Report: |
Reported in EPA TSCA Inventory.
|
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|