| Identification | |
| Name: | Benzenemethanol, a-(aminomethyl)-3-hydroxy-,hydrochloride (1:1) |
| CAS: | 4779-94-6 |
| EINECS: | 225-323-6 |
| Molecular Formula: | C8H11 N O2 . Cl H |
| Molecular Weight: | 189.66 |
| InChI: | InChI=1/C8H11NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H,5,9H2/p+1/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 162-164 °C(lit.) |
| Flash Point: | 172°C |
| Boiling Point: | 360.7°Cat760mmHg |
| Density: | 1.249g/cm3 |
| Specification: | white to almost white crystalline powder usageEng:Impurity A of phenylephrine. A phenylephrine derivative as leukotriene D4 antagonists. |
| Flash Point: | 172°C |
| Usage: | Impurity A of phenylephrine. A phenylephrine derivative as leukotriene D4 antagonists. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
