| Identification | ||
| Name: | Rhein | |
| Synonyms: | 1,8-Dihydroxy-3-Carboxy anthraquinone | |
| CAS: | 478-43-3 | |
| EINECS: | 207-521-4 | |
| Molecular Formula: | C15H8O6 | |
| Molecular Weight: | 284.22 | |
| InChI: | InChI=1/C15H8O6/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h1-5,16-17H,(H,20,21) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | OTH | |
| Flash Point: | STABILITY | |
| Boiling Point: | RELATIVE DENSITY | |
| Density: | 1.687g/cm3 | |
| Stability: | No data. | |
| Water Solubility: | <0.1 g/100 mL at 17 ºC | |
| Solubility: | Soluble | |
| Appearance: | Slightly yellowish crystalline powder | |
| Specification: | Yellowish Brown Solid usageEng:Found in the free state and as glucoside in Rheum spp, Polygonaceae (rhubarb) and in Senna leaves. A potential antioxidant resource: endophytic fungi from medicinal plants. Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection | |
| Flash Point: | STABILITY | |
| Usage: | Found in the free state and as glucoside in Rheum spp, Polygonaceae (rhubarb) and in Senna leaves. A potential antioxidant resource: endophytic fungi from medicinal plants. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
