| Identification | |
| Name: | Benzenamine,4,4'-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis- |
| Synonyms: | Benzenamine,4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-; C.I. Basic Red9 (8CI); Homolka's Base |
| CAS: | 479-73-2 |
| Molecular Formula: | C19H17 N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C19H17N3.ClH/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20H,21-22H2;1H |
| Molecular Structure: | ![(C19H17N3) Benzenamine,4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-; C.I. Basic Red9 (8CI); ...](https://img1.guidechem.com/chem/e/dict/17/479-73-2.jpg) |
| Properties | |
| Melting Point: | 268-270 deg C (decomposes) |
| Flash Point: | 297.4°C |
| Boiling Point: | 568.2°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | SOL IN ALCOHOL; VERY SLIGHTLY SOL IN WATER & ETHER Soluble in water (2-3 mg/ml), ethanol (2-25 mg/ml) ethylene glycol methyl ether (50-70 mg/ml) and methanol |
| Flash Point: | 297.4°C |
| Color: | COLORLESS TO RED CRYSTALS Dark-green crystalline powder |
| Safety Data | |
 |
|
