| Identification | |
| Name: | 3H-Pyrazol-3-one,1,2-dihydro-1,5-dimethyl-4-(1-methylethyl)-2-phenyl- |
| Synonyms: | Antipyrine,4-isopropyl- (6CI,7CI,8CI);1,2-Dihydro-1,5-dimethyl-2-phenyl-4-isopropyl-3H-pyrazol-3-one;1-Phenyl-2,3-dimethyl-4-isopropyl-3-pyrazolin-5-one;1-Phenyl-2,3-dimethyl-4-isopropylpyrazol-5-one;4-Isopropyl-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one;4-Isopropylantipyrine;4-Isopropylphenazone;Arantil P;Budirol;Causyth;Cibalgina;Eufibron;Isopropchin;Isopropylantipyrin;Isopropylantipyrine;Isopropylphenazone;Isopropyrine;Larodon; |
| CAS: | 479-92-5 |
| EINECS: | 207-539-2 |
| Molecular Formula: | C14H18N2O |
| Molecular Weight: | 230.34 |
| InChI: | InChI=1/C14H18N2O/c1-10(2)13-11(3)15(4)16(14(13)17)12-8-6-5-7-9-12/h5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.081 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.555 |
| Appearance: | solid |
| Specification: | solid usageEng:Analgesic; antipyretic; anti-inflammatory. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Refrigerator |
| Usage: | Analgesic; antipyretic; anti-inflammatory. |
| Safety Data | |
 |
|
