| Identification |
| Name: | 1,3-Benzenedicarboxylic acid, polymer with 1,4-benzenedicarboxylic acid, 1,4-butanediol and decanedioic acid |
| Synonyms: | butane-1,4-diol; decanedioic acid; isophthalic acid; terephthalic acid;25214-81-7;1,3-Benzenedicarboxylic acid, polymer with 1,4-benzenedicarboxylic acid, 1,4-butanediol and decanedioic acid;AC1L51NO;AC1Q5U39;AR-1I0973;1,4-Butanediol, terephthalic acid, isophthalic acid, sebacic acid polymer;benzene-1,3-dicarboxylic acid; butane-1,4-diol; decanedioic acid; terephthalic acid |
| CAS: | 479075-97-3 |
| Molecular Formula: | C30H40O14 |
| Molecular Weight: | 624.6302 |
| InChI: | InChI=1S/C10H18O4.2C8H6O4.C4H10O2/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;9-7(10)5-1-2-6(4-3-5)8(11)12;9-7(10)5-2-1-3-6(4-5)8(11)12;5-3-1-2-4-6/h1-8H2,(H,11,12)(H,13,14);2*1-4H,(H,9,10)(H,11,12);5-6H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Safety Data |
| |
 |
