| Identification | |
| Name: | 1-Butyl-1-methylpyrrolidinium chloride |
| Synonyms: | pyrrolidinium, 1-butyl-1-methyl-, chloride (1:1);1-butyl-1-methyl-2,3,4,5-tetrahydropyrrole Chloride; |
| CAS: | 479500-35-1 |
| Molecular Formula: | C9H20ClN |
| Molecular Weight: | 177.71 |
| InChI: | InChI=1/C9H20N.ClH/c1-3-4-7-10(2)8-5-6-9-10;/h3-9H2,1-2H3;1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 1-Butyl-1-methylpyrrolidinium chloride with the CAS number 479500-35-1 is also called pyrrolidinium, 1-butyl-1-methyl-, chloride (1:1). The IUPAC name is 1-butyl-1-methylpyrrolidin-1-ium chloride. It is molecular formula is C9H20ClN. This chemical belongs to the following product categories: (1)Ammonium Chlorides (Quaternary); (2)Quaternary Ammonium Compounds; (3)Chemical Synthesis; (4)Ionic Liquids; (5)Pyrrolidinium. Properties Computed from Structure: (1)H-Bond Donor: 0; (2)H-Bond Acceptor: 1; (3)Rotatable Bond Count: 3; (4)Exact Mass: 177.128427; (5)MonoIsotopic Mass: 177.128427; (6)Topological Polar Surface Area: 0; (7)Heavy Atom Count: 11; (8)Formal Charge: 0; (9)Complexity: 92.9; (10)Isotope Atom Count: 0; (11)Defined Atom StereoCenter Count: 0; (12)Undefined Atom StereoCenter Count: 0; (13)Defined Bond StereoCenter Count: 0; (14)Undefined Bond StereoCenter Count: 0; (15)Covalently-Bonded Unit Count: 2. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
