| Identification | |
| Name: | 4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)- |
| Synonyms: | 4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R-trans)-;Flavanone,3,3',4',5,7-pentahydroxy- (8CI);(+)-Dihydroquercetin;(+)-Taxifolin;(+)-trans-Taxifolin;(2R,3R)-(+)-Taxifolin;(2R,3R)-3,3',4',5,7-Pentahydroxyflavanone;(2R,3R)-Dihydroquercetin;2,3-Dihydroquercetin;3,5,7,3',4'-Pentahydroxyflavanone;Dihydroquercetin;Diquertin;Distylin;Lariksin;Lavitol;Taxifolin;Taxifoliol; |
| CAS: | 480-18-2 |
| EINECS: | 207-543-4 |
| Molecular Formula: | C15H12O7 |
| Molecular Weight: | 304.27 |
| InChI: | InChI=1/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 230-233ºC |
| Flash Point: | 264.2ºC |
| Boiling Point: | 687.6ºC |
| Density: | 1.702 g/cm3 |
| Refractive index: | 1.762 |
| Appearance: | Yellowish powder |
| Specification: |
Taxifolin (480-18-2) is a white to yellowish solid powder and dissolves in nonpolar solvents (alcohol, acetone, ether), hot water, oil. The product is stable. It should keep tightly closed in dark place and a cool, well-ventilated area. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 264.2ºC |
| Storage Temperature: | -20?C Freezer |
| Usage: | An antioxidant flavenoid. |
| Safety Data | |
 |
|
