| Identification | |
| Name: | SOMINAT |
| Synonyms: | 3h-pyrazol-3-one,1,2-dihydro-1,5-dimethyl-2-phenyl-,compd.with2,2,2-trichlo;antipyrine,compd.withchloralhydrate(1:2);dichloralantipyrin;dichloralantipyrine;dormuphar;ibiodorm;kloralfenazon;ro-1,1-ethanediol(1:2) |
| CAS: | 480-30-8 |
| EINECS: | 207-546-0 |
| Molecular Formula: | C11H12N2O•2C2H3Cl3O2 |
| Molecular Weight: | 519.05 |
| InChI: | InChI=1/C11H12N2O.2C2H3Cl3O2/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10;2*3-2(4,5)1(6)7/h3-8H,1-2H3;2*1,6-7H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Sominat with CAS registry number of 480-30-8 is known as Antipyrine, compound with chloral hydrate (1:2) ; Antipyrine, compd. with chloral hydrate (1:2) ; Dichloralantipyrin ; Dichloralantipyrine ; Dichloralphenazone ; Dichloralphenazone [BAN] ; Dormuphar ; DEA No. 2467 ; Ibiodorm ; Kloralfenazon ; Sedor ; Welldorm ; 1,2-Dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one, compd. with 2,2,2-trichloro-1,1-ethanediol (1:2) ; 1,2-Dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one, compound with 2,2,2-trichloroethane-1,1-diol (1:2) ; 3H-Pyrazol-3-one, 1,2-dihydro-1,5-dimethyl-2-phenyl-, compd. with 2,2,2-trichloro-1,1-ethanediol (1:2) . |
| Safety Data | |
 |
|
