| Identification | |
| Name: | Chrysin |
| Synonyms: | 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one;Flavone, 5,7-dihydroxy-;5,7-Dihydroxy-2-phenyl-4H-benzo(b)pyran-4-one;4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-phenyl- (9CI);NSC 407436;BRN 0233276;5-18-04-00076 (Beilstein Handbook Reference);5,7-Dihydroxyflavone; |
| CAS: | 480-40-0 |
| EINECS: | 207-549-7 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.24 |
| InChI: | InChI=1/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.443 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.698 |
| Solubility: | Insoluble |
| Appearance: | beige powder |
| Specification: |
?Chrysin , its cas register number is 480-40-0. It also can be called?5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one ; 5,7-Dihydroxyflavone ; 5-18-04-00076 (Beilstein Handbook Reference) ; BRN 0233276 ; Galangin flavanone ; NSC 407436 ; 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-phenyl- (9CI) ; 5,7-Dihydroxy-2-phenyl-4H-benzo(b)pyran-4-one ; Flavone, 5,7-dihydroxy- .It is a?beige powder.?It was once believed to be an effective aromatase inhibitor, decreasing the levels of estrogen in the body. However, there is growing consensus that chrysin has no effect on estrogen levels in either animals or humans. |
| Usage: | Believed to maintain higher blood levels of testosterone. |
| Safety Data | |
 |
|
