Identification |
Name: | Benzoic acid,2,4-dihydroxy-6-methyl-, 4-carboxy-3-hydroxy-5-methylphenyl ester |
Synonyms: | Benzoic acid, 4-[(2,4-dihydroxy-6-methylbenzoyl)oxy]-2-hydroxy-6-methyl-; |
CAS: | 480-56-8 |
Molecular Formula: | C16H14O7 |
Molecular Weight: | 318.27816 |
InChI: | InChI=1S/C16H14O7/c1-7-3-9(17)5-11(18)14(7)16(22)23-10-4-8(2)13(15(20)21)12(19)6-10/h3-6,17-19H,1-2H3,(H,20,21) |
Molecular Structure: |
![(C16H14O7) Benzoic acid, 4-[(2,4-dihydroxy-6-methylbenzoyl)oxy]-2-hydroxy-6-methyl-;](https://img1.guidechem.com/chem/e/dict/33/480-56-8.jpg) |
Properties |
Melting Point: | 175-176ºC |
Density: | 1.492 g/cm3 |
Refractive index: | 1.675 |
Water Solubility: | insoluble in water and hexane; soluble in DMSO, ethanol, and ethyl acetate. |
Solubility: | insoluble in water and hexane; soluble in DMSO, ethanol, and ethyl acetate. |
Appearance: | colorless crystals |
Safety Data |
|
 |