| Identification | |
| Name: | 2,4,6-Trimethylbenzoic acid |
| Synonyms: | Mesitylenecarboxylic acid; Mesitoic acid; Mesitylene-2-carboxylic acid; 4-Fluoro Acetophenone; 2,4,6-Trimethyl Benzoic Acid |
| CAS: | 480-63-7 |
| EINECS: | 207-553-9 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.088 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. Stable under normal temperatures and pressures. |
| Water Solubility: | Soluble in ethanol and chloroform, etc |
| Solubility: | Soluble in ethanol and chloroform, etc |
| Appearance: | white crystal |
| Specification: | white to almost white crystalline powder Safety Statements:22-24/25-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. Keep under a nitrogen blanket. Flammables-area. |
| Safety Data | |
 |
|
