Identification |
Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-nitro- |
Synonyms: | Barbituricacid, 5-nitro- (7CI,8CI); Dilituric acid (6CI);2,4,6-Trihydroxy-5-nitropyrimidine; 5-Nitro-2,4,6-pyrimidinetriol;5-Nitro-2,4,6-trihydroxypyrimidine; 5-Nitro-6-hydroxyuracil; 5-Nitrobarbituricacid; 6-Hydroxy-5-nitro-2,4(1H,3H)-pyrimidinedione; NSC 5071 |
CAS: | 480-68-2 |
EINECS: | 207-557-0 |
Molecular Formula: | C4H3 N3 O5 |
Molecular Weight: | 173.10 |
InChI: | InChI=1/C4H3N3O5/c8-2-1(7(11)12)3(9)6-4(10)5-2/h1H,(H2,5,6,8,9,10) |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.79g/cm3 |
Refractive index: | 1.581 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | °C |
Safety Data |
|
 |