| Identification | |
| Name: | 2,2'-Bithiophene,5,5'-dibromo- |
| Synonyms: | 5,5'-Dibromo-2,2'-bithienyl;5,5'-Dibromo-2,2'-dithienyl;5,5'-Dibromo-2,2'-dithiophene; |
| CAS: | 4805-22-5 |
| Molecular Formula: | C8H4Br2S2 |
| Molecular Weight: | 324.05 |
| InChI: | InChI=1/C8H4Br2S2/c9-7-3-1-5(11-7)6-2-4-8(10)12-6/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.5°C |
| Boiling Point: | 318.6°C at 760 mmHg |
| Density: | 1.951g/cm3 |
| Refractive index: | 1.683 |
| Appearance: | white to light yellow shiny flakes |
| Specification: |
5,5'-Dibromo-2,2'-bithiophene , with CAS number of 4805-22-5, can be called 5,5'-dibromo-2,2'-dithiophene ; 5,5''-Dibromo-2,2''-bithiophene: 99.8%;2,2'-Bi(5-bromothiophene) ; 5,5'-Dibromo-2,2'-bithiophene,99% . It is a white to light yellow shiny flakes, can be used as a termination reagent for polymer ization. |
| Flash Point: | 146.5°C |
| Usage: | A termination reagent for polymer ization |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
