| Identification | |
| Name: | 5-Hydroxy-p-naphthoquinone |
| Synonyms: | 5-Hydroxy-1,4-naphthalenedione; Juglone; 5-hydrocy-1,4-naphthoquinone |
| CAS: | 481-39-0 |
| EINECS: | 207-567-5 |
| Molecular Formula: | C10H6O3 |
| Molecular Weight: | 174.15 |
| InChI: | InChI=1/C10H6O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-5,12H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.439 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.662 |
| Water Solubility: | SOLUBLE IN HOT WATER |
| Solubility: | SOLUBLE IN HOT WATER |
| Appearance: | Red powder |
| Specification: | Orange to brown crystalline powder Safety Statements:22-26-36/37/39-45-37/39-28A 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Usage: | Textile dye. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
