| Identification | |
| Name: | Ethanamine,2-[[(2,6-dichlorophenyl)methyl]thio]- |
| Synonyms: | 2-(2,6-Dichlorobenzylthio)ethylamine |
| CAS: | 48133-71-7 |
| Molecular Formula: | C9H11 Cl2 N S |
| Molecular Weight: | 236.16 |
| InChI: | InChI=1/C9H11Cl2NS/c10-8-2-1-3-9(11)7(8)6-13-5-4-12/h1-3H,4-6,12H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.7°C |
| Boiling Point: | 332.2°Cat760mmHg |
| Density: | 1.309g/cm3 |
| Refractive index: | 1.6 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 154.7°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
