| Identification | |
| Name: | 3-Thiophenecarboxylicacid, 2-amino-4,5-dimethyl-, ethyl ester |
| Synonyms: | 2-Amino-3-(ethoxycarbonyl)-4,5-dimethylthiophene;2-Amino-3-carbethoxy-4,5-dimethylthiophene; 2-Amino-4,5-dimethyl-3-thiophenecarboxylicacid ethyl ester; Ethyl 2-amino-4,5-dimethylthiophene-3-carboxylate; NSC 86908 |
| CAS: | 4815-24-1 |
| EINECS: | 225-387-5 |
| Molecular Formula: | C9H13 N O2 S |
| Molecular Weight: | 199.27 |
| InChI: | InChI=1/C9H13NO2S/c1-4-12-9(11)7-5(2)6(3)13-8(7)10/h4,10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3335 |
| Melting Point: | 90 ºC |
| Density: | 1.185 g/cm3 |
| Refractive index: | 1.567 |
| Appearance: | light amber solid |
| Specification: |
3-Thiophenecarboxylicacid, 2-amino-4,5-dimethyl-, ethyl ester , its cas register number is 4815-24-1. It also can be called Ethyl 2-amino-4,5-dimethyl3-thenoate ; NSC 86908 and so on. 3-Thiophenecarboxylicacid, 2-amino-4,5-dimethyl-, ethyl ester (CAS NO.4815-24-1) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
