| Identification | |
| Name: | Diphenic acid |
| Synonyms: | Diphenicacid (6CI,8CI);2,2'-Bibenzoic acid;2,2'-Biphenyldicarboxylic acid;2,2'-Dicarboxybiphenyl;2,2'-Diphenic acid;2'-Carboxybiphenyl-2-carboxylicacid;Diphenyl-2,2'-dicarboxylic acid;NSC 1966;o,o'-Bibenzoic acid;o,o'-Diphenic acid; |
| CAS: | 482-05-3 |
| EINECS: | 207-576-4 |
| Molecular Formula: | C14H10O4 |
| Molecular Weight: | 242.23 |
| InChI: | InChI=1/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 223.7 ºC |
| Boiling Point: | 422.8 ºC at 760 mmHg |
| Density: | 1.347 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | insoluble (20 ºC) in water |
| Appearance: | slightly gray powder |
| Specification: | Off-white powder Safety Statements:26-37/39-37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 37:Wear suitable gloves |
| HS Code: | 29173980 |
| Flash Point: | 223.7 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
