| Identification | |
| Name: | 2-Propenoic acid,2-bromoethyl ester |
| Synonyms: | Acrylicacid, 2-bromoethyl ester (6CI,7CI,8CI);Ethanol, 2-bromo-, acrylate (8CI);2-Bromoethyl acrylate;NSC 18591;2-Bromoethyl prop-2-enoate;Acrylic acid 2-bromoethyl ester; |
| CAS: | 4823-47-6 |
| EINECS: | -0 |
| Molecular Formula: | C5H7BrO2 |
| Molecular Weight: | 179.01 |
| InChI: | InChI=1/C5H7BrO2/c1-2-5(7)8-4-3-6/h2H,1,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 52-53°C 5mm |
| Density: | 1.457g/cm3 |
| Refractive index: | 1.472 |
| Solubility: | Insoluble in water |
| Appearance: | Colorless liquid |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
