Identification |
Name: | 6-Isoquinolinol,1-[[(2S,3R,11bS)-3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2H-benzo[a]quinolizin-2-yl]methyl]-1,2,3,4-tetrahydro-7-methoxy-,(1R)- |
Synonyms: | Cephaeline(6CI,7CI,8CI); Emetan-6'-ol, 7',10,11-trimethoxy-; (-)-Cephaeline;7',10,11-Trimethoxyemetan-6'-ol; Cepheline; Desmethylemetine;Dihydropsychotrine |
CAS: | 483-17-0 |
EINECS: | 207-591-6 |
Molecular Formula: | C28H38 N2 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C28H38N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3/t17-,20-,23+,24-/m0/s1 |
Molecular Structure: |
 |
Properties |
Transport: | 1544 |
Melting Point: | 115-1160C |
Flash Point: | 325.1°C |
Boiling Point: | 614°Cat760mmHg |
Density: | 1.21g/cm3 |
Refractive index: | 1.614 |
Specification: | Crystalline Solid usageEng:Has been used as an emetic and expectorant |
Packinggroup: | III |
Flash Point: | 325.1°C |
Usage: | Has been used as an emetic and expectorant |
Safety Data |
|
 |