| Identification | |
| Name: | 2-Butenamide,N-ethyl-N-(2-methylphenyl)- |
| Synonyms: | o-Crotonotoluidide,N-ethyl- (6CI,7CI,8CI);Crotalgin;Crotamitex;Crotamitone;Crotonyl N-ethyl-o-toluidine;Eurax;Euraxil;N-Crotonyl-N-ethyl-o-toluidine;N-Ethyl-o-crotonotoluidide;Veteusan; |
| CAS: | 483-63-6 |
| EINECS: | 207-596-3 |
| Molecular Formula: | C13H17NO |
| Molecular Weight: | 203.28 |
| InChI: | InChI=1/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.014 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | n20/D 1.54(lit.) |
| Solubility: | Insoluble |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Fungicide, insecticide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
