| Identification |
| Name: | Phenanthrene,1-methyl-7-(1-methylethyl)- |
| Synonyms: | Phenanthrene,7-isopropyl-1-methyl- (7CI,8CI);Retene (6CI);1-Methyl-7-(1-methylethyl)phenanthrene;1-Methyl-7-isopropylphenanthrene;7-Isopropyl-1-methylphenanthrene;NSC 26317; |
| CAS: | 483-65-8 |
| EINECS: | 207-597-9 |
| Molecular Formula: | C18H18 |
| Molecular Weight: | 234.3355 |
| InChI: | InChI=1/C18H18/c1-12(2)14-7-10-17-15(11-14)8-9-16-13(3)5-4-6-18(16)17/h4-12H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 483-65-8 |
| Flash Point: | 177.8 ºC |
| Boiling Point: | 208 ºC10 mm Hg(lit.) |
| Density: | 1.046 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.642 |
| Water Solubility: | negligible Stability Stable. Incompatible with strongoxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of |
| Solubility: | negligible |
| Appearance: | beige flakes |
| Flash Point: | 177.8 ºC |
| Safety Data |
| |
 |
