| Identification | |
| Name: | 2-DECALONE |
| Synonyms: | 2-DECALONE;DECAHYDRO-2-NAPHTHALENONE;PERHYDRONAPHTHALEN-2-ONE;2(1H)-Naphthalenone, octahydro-;2-Decalone (cis-trans);2-Decalone, mixture of cis and trans;2-Decalone,mixture of cis and trans;bicyclo(4.4.0)decan-2-one |
| CAS: | 4832-17-1 |
| EINECS: | 225-411-4 |
| Molecular Formula: | C10H16O |
| Molecular Weight: | 152.23 |
| InChI: | InChI=1/C10H16O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-9H,1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 215 °F |
| Boiling Point: | 96 °C2.5 mm Hg(lit.) |
| Density: | 0.979 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.491(lit.) |
| Flash Point: | 215 °F |
| Safety Data | |
 |
|
