Specification: |
The 3,6-Dichloro-2-(5-chloro-2-thienyl)imidazo[1,2-b]pyridazine, with CAS registry number 483367-55-1, has the systematic name of 3,6-dichloro-2-(5-chlorothiophen-2-yl)imidazo[1,2-b]pyridazine. Besides this, it is also called imidazo[1,2-b]pyridazine, 3,6-dichloro-2-(5-chloro-2-thienyl)-. And the chemical formula of this chemical is C10H4Cl3N3S.
Physical properties of 3,6-Dichloro-2-(5-chloro-2-thienyl)imidazo[1,2-b]pyridazine: (1)ACD/LogP: 4.16; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.16; (4)ACD/LogD (pH 7.4): 4.16; (5)ACD/BCF (pH 5.5): 851.42; (6)ACD/BCF (pH 7.4): 851.43; (7)ACD/KOC (pH 5.5): 4355.09; (8)ACD/KOC (pH 7.4): 4355.12; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 58.43 Å2; (13)Index of Refraction: 1.795; (14)Molar Refractivity: 72.65 cm3; (15)Molar Volume: 170.7 cm3; (16)Polarizability: 28.8×10-24cm3; (17)Surface Tension: 65.4 dyne/cm.
You can still convert the following datas into molecular structure:
(1)SMILES: Clc3sc(c2nc1ccc(Cl)nn1c2Cl)cc3
(2)InChI: InChI=1/C10H4Cl3N3S/c11-6-2-4-8-14-9(10(13)16(8)15-6)5-1-3-7(12)17-5/h1-4H
(3)InChIKey: BKFQPHFPGRTGPB-UHFFFAOYAH
(4)Std. InChI: InChI=1S/C10H4Cl3N3S/c11-6-2-4-8-14-9(10(13)16(8)15-6)5-1-3-7(12)17-5/h1-4H
(5)Std. InChIKey: BKFQPHFPGRTGPB-UHFFFAOYSA-N
|