| Identification | |
| Name: | 9-Phenanthrenol |
| Synonyms: | 9-Phenanthrol(6CI,7CI,8CI); 9-Hydroxyphenanthrene; NSC 50554 |
| CAS: | 484-17-3 |
| EINECS: | 207-602-4 |
| Molecular Formula: | C14H10 O |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.7°C |
| Boiling Point: | 404.5°C at 760 mmHg |
| Density: | 1.244g/cm3 |
| Refractive index: | 1.753 |
| Specification: |
9-Phenanthrol , its cas register number is 484-17-3. It also can be called 9-Hydroxyphenanthrene ; Phenanthren-9-ol .It is a brown powder. |
| Flash Point: | 197.7°C |
| Storage Temperature: | Refrigerator |
| Usage: |
9-Phenanthrol (CAS NO.484-17-3) can be used as an inhibitor of AMP-dependent protein kinase catalytic subunit. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
