Identification |
Name: | 1-(2-ethoxyethyl) 4-methyl 2-iodobenzene-1,4-dicarboxylate |
Synonyms: | 4842-11-9;AC1L3CNM;Ethanol, 2-ethoxy-, ester with methyl 5-iodoisophthalate;1-(2-ethoxyethyl) 4-methyl 2-iodobenzene-1,4-dicarboxylate;1-O-(2-ethoxyethyl) 4-O-methyl 2-iodobenzene-1,4-dicarboxylate |
CAS: | 4842-11-9 |
Molecular Formula: | C13H15IO5 |
Molecular Weight: | 378.1597 |
InChI: | InChI=1/C13H15IO5/c1-3-18-6-7-19-13(16)10-5-4-9(8-11(10)14)12(15)17-2/h4-5,8H,3,6-7H2,1-2H3 |
Molecular Structure: |
![(C13H15IO5) 4842-11-9;AC1L3CNM;Ethanol, 2-ethoxy-, ester with methyl 5-iodoisophthalate;1-(2-ethoxyethyl) 4-meth...](https://img.guidechem.com/pic/image/4842-11-9.png) |
Properties |
Flash Point: | 189.5°C |
Boiling Point: | 389.7°C at 760 mmHg |
Density: | 1.555g/cm3 |
Refractive index: | 1.557 |
Flash Point: | 189.5°C |
Safety Data |
|
![](/images/detail_15.png) |