| Identification | |
| Name: | 6,7-Isoquinolinediol,1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydro-2-methyl- |
| CAS: | 485-33-6 |
| EINECS: | 207-613-4 |
| Molecular Formula: | C17H19 N O4 |
| Molecular Weight: | 436.29 |
| InChI: | InChI=1/C17H19NO4/c1-18-5-4-11-8-16(21)17(22)9-12(11)13(18)6-10-2-3-14(19)15(20)7-10/h2-3,7-9,13,19-22H,4-6H2,1H3/p+1/t13-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 232-234 °C(lit.) |
| Flash Point: | 323°C |
| Boiling Point: | 548°Cat760mmHg |
| Density: | 1.373g/cm3 |
| Specification: | off-white to yellowish or beige-grey cryst. powder Safety Statements:27-28-36/37/39-45 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 323°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
