| Identification | |
| Name: | Cytisine |
| Synonyms: | (-)-cytisine ; SOPHORINE; 1,2,3,4,5,6-Hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one; 1,2,3,4,5,6-Hexahydro-1,5-methano-pyrido[1,2-a][1,5]diazocin; 1,5-Methano-8H-pyrido(1,2-a)(1,5)diazocin-8-one, 1,2,3,4,5,6-hexahydro-; 1,5-Methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, 1,2,3,4,5,6-hexahydro-, (1R)-; 1,5-Methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, 1,2,3,4,5,6-hexahydro-, (1R-cis)-; 2-a)(1,5)diazocin-8-one,1,2,3,4,5,6-hexahydro-5-methano-8h-pyrido(1; 5)diazocin-8-one,1,2,3,4,5,6-hexahydro-5-methano-8h-pyrido((1r)-2-a)(1 |
| CAS: | 485-35-8 |
| EINECS: | 207-616-0 |
| Molecular Formula: | C11H14N2O |
| Molecular Weight: | 190.24 |
| InChI: | InChI=1/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8?,9-/m1/s1 |
| Molecular Structure: | ![(C11H14N2O) (-)-cytisine ; SOPHORINE; 1,2,3,4,5,6-Hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one; 1,2...](https://img.guidechem.com/casimg/485-35-8.gif) |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.24 g/cm3 |
| Water Solubility: | Soluble to 100 mM in Water |
| Solubility: | Soluble to 100 mM in Water |
| Appearance: | Off-White to Tan Crystalline Solid |
| Specification: |
?Cytisine , its cas register number 485-35-8. It also can be called?(1R,5S)-1,2,3,4,5,6-Hexahydro-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one ;?and 1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, 1,2,3,4,5,6-hexahydro-, (1R,5S)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store at RT |
| Color: | light yellow |
| Usage: | Toxic priniciple in seed of Laburnum anagyroides and other Leguminosae. A neuronal nicotinic acetylcholine agonist. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
