| Identification | |
| Name: | Formononetin |
| Synonyms: | Red Clover Extract |
| CAS: | 485-72-3 |
| EINECS: | 207-623-9 |
| Molecular Formula: | C16H12O4 |
| Molecular Weight: | 268.27 |
| InChI: | InChI=1/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 479.4 oC at 760 mmHg |
| Boiling Point: | 479.4 oC at 760 mmHg |
| Density: | 1.329 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.641 |
| Solubility: | Insoluble |
| Appearance: | off-white powder |
| Flash Point: | 479.4 oC at 760 mmHg |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Treatment and prevention of osteoporosis. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
