| Identification | |
| Name: | 1H-Benzimidazole,2-(chloromethyl)- |
| Synonyms: | Benzimidazole,2-(chloromethyl)- (6CI,7CI,8CI);2-(Chloromethyl)-1H-benzimidazole;2-(Chloromethyl)benzimidazole;NSC 103708;NSC 15436; |
| CAS: | 4857-04-9 |
| EINECS: | 225-452-8 |
| Molecular Formula: | C8H7ClN2 |
| Molecular Weight: | 166.61 |
| InChI: | InChI=1/C8H7ClN2/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 209.9°C |
| Boiling Point: | 371°C at 760 mmHg |
| Density: | 1.356g/cm3 |
| Refractive index: | 1.679 |
| Appearance: | Yellow to bown crystalline powder |
| Specification: |
2-(Chloromethyl)-benzimidazole , its cas register number is 4857-04-9. It also can be called 2-(Chloromethyl)benzimidazole . 2-(Chloromethyl)-benzimidazole (CAS NO.4857-04-9) is not compatible with strong oxidizing agents, strong bases. And it should avoid the condition of incompatible materials. Whlie, its hazardous decomposition products are hydrogen chloride, nitrogen oxides, carbon monoxide, carbon dioxide. And its hazardous polymerization has not been reported. |
| Flash Point: | 209.9°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
