| Identification | |
| Name: | 5-Isoxazolecarboxylicacid, 3-methyl- |
| Synonyms: | 3-Methyl-5-isoxazolecarboxylicacid;3-Methyl-5-isoxazolylcarboxylic acid;5-Carboxy-3-methylisoxazole;U10387; |
| CAS: | 4857-42-5 |
| EINECS: | 225-454-9 |
| Molecular Formula: | C5H5NO3 |
| Molecular Weight: | 127.0981 |
| InChI: | InChI=1/C5H5NO3/c1-3-2-4(5(7)8)9-6-3/h2H,1H3,(H,7,8)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.348g/cm3 |
| Specification: |
The 3-Methylisoxazole-5-carboxylic acid with its cas register number is 4857-42-5. It also can be called as 5-Isoxazolecarboxylicacid, 3-methyl- and the IUPAC Name about this chemical is 5-methyl-1,2-oxazole-3-carboxylic acid. It belongs to the Heterocycles series. Physical properties about 3-Methylisoxazole-5-carboxylic acid are: (1)ACD/LogP: 0.68; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 63.33Å2; (10)Index of Refraction: 1.514; (11)Molar Refractivity: 28.399 cm3; (12)Molar Volume: 94.256 cm3; (13)Polarizability: 11.258x10-24cm3; (14)Surface Tension: 53.715 dyne/cm; (15)Enthalpy of Vaporization: 58.437 kJ/mol. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
