Identification |
Name: | Ethanamine,2-[[[4-(butylthio)phenyl]phenylmethyl]thio]-N,N-dimethyl- |
Synonyms: | Ethylamine,2-[[p-(butylthio)-a-phenylbenzyl]thio]-N,N-dimethyl- (6CI,7CI,8CI);2-[[p-(Butylthio)-a-phenylbenzyl]thio]-N,N-dimethylethylamine;Captodiam;Captodiame; Captodiamin; Captodiamine;Captodramin;Captodramine;Covatin;p-Butylmercaptobenzhydryl b-dimethylaminoethyl sulfide;p-Butylthiodiphenylmethyl2-dimethylaminoethyl sulfide |
CAS: | 486-17-9 |
EINECS: | 207-629-1 |
Molecular Formula: | C21H29 N S2 |
Molecular Weight: | 359.63 |
InChI: | InChI=1/C21H29NS2/c1-4-5-16-23-20-13-11-19(12-14-20)21(24-17-15-22(2)3)18-9-7-6-8-10-18/h6-14,21H,4-5,15-17H2,1-3H3 |
Molecular Structure: |
![(C21H29NS2) Ethylamine,2-[[p-(butylthio)-a-phenylbenzyl]thio]-N,N-dimethyl- (6CI,7CI,8CI);2-[[p-(Butylthio)-a-ph...](https://img1.guidechem.com/chem/e/dict/110/486-17-9.jpg) |
Properties |
Flash Point: | 235.7°C |
Boiling Point: | 466.1°Cat760mmHg |
Density: | 1.08g/cm3 |
Refractive index: | 1.596 |
Specification: |
Captodiame , its cas register number is 486-17-9. It also can be called Captodramine ; Covatine ; Covatix ; and Suvren . Captodiame (CAS NO.486-17-9) is a derivative of diphenhydramine, and is an antihistamine sold which is used as a sedative and anxiolytic.
|
Flash Point: | 235.7°C |
Safety Data |
|
 |