| Identification | |
| Name: | (-)-cotinine |
| Synonyms: | (S)-(-)-1-Methyl-5-(3-pyridyl)-2-pyrrolidinone |
| CAS: | 486-56-6 |
| EINECS: | 207-634-9 |
| Molecular Formula: | C10H12N2O |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Flash Point: | >230 °F |
| Density: | 145 |
| Stability: | Stable. Incompatible with strong oxidizing agents. May be heat sensitive - store cold. |
| Refractive index: | 1.555 |
| Solubility: | In water, 1.0X10+6 mg/L at 25 deg C /miscible/ (est) |
| Specification: | Colourless to Light Brown Solid usageEng:A major metabolite of nicotine in humans Safety Statements:7-16-36/37-45-36-26 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Biological Activity: | Major metabolite of nicotine. Shown to activate a subpopulation of α 3/ α 6 β 2 nAChRs in monkey striatum. Displays cognition-enhancing effects in vivo . |
| Flash Point: | >230 °F |
| Storage Temperature: | 2-8°C |
| Color: | Viscous oil |
| Usage: | A major metabolite of nicotine in humans |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
