| Identification | |
| Name: | 9H-Pyrido[3,4-b]indole,1-methyl- |
| Synonyms: | 2,9-Pyridindole,1-methyl- (3CI); 1-Methyl-9H-pyrido[3,4-b]indole; 1-Methyl-b-carboline; Aribin; Aribine;Harman; Harmane; Indoter; Locuturin; Locuturine; NSC 54439; Zygofabagine |
| CAS: | 486-84-0 |
| EINECS: | 207-642-2 |
| Molecular Formula: | C12H10 N2 |
| Molecular Weight: | 182.24 |
| InChI: | InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| Molecular Structure: | ![(C12H10N2) 2,9-Pyridindole,1-methyl- (3CI); 1-Methyl-9H-pyrido[3,4-b]indole; 1-Methyl-b-carboline; Aribin; Arib...](https://img1.guidechem.com/chem/e/dict/27/486-84-0.jpg) |
| Properties | |
| Transport: | 1544 |
| Melting Point: | 235-238 °C(lit.) |
| Flash Point: | 176.2°C |
| Boiling Point: | 386.9°Cat760mmHg |
| Density: | 1.252g/cm3 |
| Refractive index: | 1.75 |
| Specification: | Off-White Solid usageEng:Harman alkaloid like harmane, harmine, harmalol, harmaline obtained from Banisteriopsis caapi L. showed cytotoxicity, antimicrobial activity against Staphylococcus aureus, Escherichia coli, Proteus vulgaris and Candida albicans. Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Biological Activity: | Proposed as the endogenous ligand for imidazoline binding sites. Binds to I 1 -sites in rat kidney with an IC 50 of 31 nM, and I 2 -sites with a K i of 49 nM. In vivo, produces a dose-dependent hypotension that is reversed by efaroxan (2-(2-Ethyl-2,3-dihydro-2-benzofuranyl)-4,5-dihydro-1H-imidazole hydrochloride ). Also a potent inhibitor of monoamine oxidases A and B (I 50 values are 0.5 and 5 μ M respectively). |
| Flash Point: | 176.2°C |
| Storage Temperature: | Store at RT |
| Usage: |
1-Methyl-9H-pyrido[3,4-b]indole (CAS NO.486-84-0) is harman alkaloid like harmane, harmine, harmalol, harmaline obtained from Banisteriopsis caapi L which showed cytotoxicity, antimicrobial activity against Staphylococcus aureus, Escherichia coli, Proteus vulgaris and Candida albicans. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
